ChemNet > CAS > 3156-39-6 beta,2-Dinitrostyrene
3156-39-6 beta,2-Dinitrostyrene
| 상품명칭 |
beta,2-Dinitrostyrene |
| 별명 |
2-Nitro-1-(2-nitrophenyl)ethene~2-Nitro-beta-nitrostyrene; 1-nitro-2-[(E)-2-nitroethenyl]benzene |
| 분자식 |
C8H6N2O4 |
| 분자량 |
194.1442 |
| InChI |
InChI=1/C8H6N2O4/c11-9(12)6-5-7-3-1-2-4-8(7)10(13)14/h1-6H/b6-5+ |
| cas번호 |
3156-39-6 |
| 분자 구조 |
|
| 밀도 |
1.401g/cm3 |
| 비등점 |
356.6°C at 760 mmHg |
| 굴절 지수 |
1.642 |
| 인화점 |
183.3°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
