ChemNet > CAS > 31805-83-1 1,3-Bis(methylthio)-2-propanol
31805-83-1 1,3-Bis(methylthio)-2-propanol
상품명칭 |
1,3-Bis(methylthio)-2-propanol |
별명 |
1,3-Bis(methylthio)propan-2-ol; 1,3-bis(methylsulfanyl)propan-2-ol |
분자식 |
C5H12OS2 |
분자량 |
152.2782 |
InChI |
InChI=1/C5H12OS2/c1-7-3-5(6)4-8-2/h5-6H,3-4H2,1-2H3 |
cas번호 |
31805-83-1 |
EC번호 |
250-814-7 |
분자 구조 |
|
밀도 |
1.112g/cm3 |
비등점 |
278.4°C at 760 mmHg |
굴절 지수 |
1.536 |
인화점 |
135.8°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|