ChemNet > CAS > 31874-34-7 2,4-Dimethoxybenzaldoxime
31874-34-7 2,4-Dimethoxybenzaldoxime
상품명칭 |
2,4-Dimethoxybenzaldoxime |
별명 |
1-(2,4-dimethoxyphenyl)-N-hydroxymethanimine; 2,4-dimethoxybenzaldehyde oxime |
분자식 |
C9H11NO3 |
분자량 |
181.1885 |
InChI |
InChI=1/C9H11NO3/c1-12-8-4-3-7(6-10-11)9(5-8)13-2/h3-6,11H,1-2H3/b10-6+ |
cas번호 |
31874-34-7 |
분자 구조 |
|
밀도 |
1.11g/cm3 |
비등점 |
304.9°C at 760 mmHg |
굴절 지수 |
1.501 |
인화점 |
138.2°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|