ChemNet > CAS > 32690-28-1 4,5-Dinitro-o-phenylenediamine
32690-28-1 4,5-Dinitro-o-phenylenediamine
상품명칭 |
4,5-Dinitro-o-phenylenediamine |
별명 |
4,5-Dinitro-1,2-diaminobenzene; 4,5-dinitrobenzene-1,2-diamine |
분자식 |
C6H6N4O4 |
분자량 |
198.1362 |
InChI |
InChI=1/C6H6N4O4/c7-3-1-5(9(11)12)6(10(13)14)2-4(3)8/h1-2H,7-8H2 |
cas번호 |
32690-28-1 |
분자 구조 |
|
밀도 |
1.683g/cm3 |
녹는 점 |
213℃ |
비등점 |
541.1°C at 760 mmHg |
굴절 지수 |
1.747 |
인화점 |
281°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|