ChemNet > CAS > 33018-91-6 Monoethylpimelate
33018-91-6 Monoethylpimelate
| 상품명칭 |
Monoethylpimelate |
| 별명 |
Ethyl hydrogen pimelate; Heptanedioic acid monoethyl ester; Monoethyl pimelate; Pimelic acid monoethyl ester; Ethylhydrogenpimelate; Pimelicacidmonoethylester; 7-ethoxy-7-oxoheptanoic acid; Boc-His(Tos)-Merrifield resin |
| 분자식 |
C9H16O4 |
| 분자량 |
188.2209 |
| InChI |
InChI=1/C9H16O4/c1-2-13-9(12)7-5-3-4-6-8(10)11/h2-7H2,1H3,(H,10,11) |
| cas번호 |
33018-91-6 |
| EC번호 |
251-346-6 |
| 분자 구조 |
|
| 밀도 |
1.074g/cm3 |
| 비등점 |
288.7°C at 760 mmHg |
| 굴절 지수 |
1.449 |
| 인화점 |
108°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/38:Irritating to eyes and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
