ChemNet > CAS > 33143-29-2 2,2-dimethyl-2H-chromene-6-carbonitrile
33143-29-2 2,2-dimethyl-2H-chromene-6-carbonitrile
상품명칭 |
2,2-dimethyl-2H-chromene-6-carbonitrile |
별명 |
2,2-Dimethyl-2H-chromeme-6-carbonitrile |
분자식 |
C12H11NO |
분자량 |
185.2218 |
InChI |
InChI=1/C12H11NO/c1-12(2)6-5-10-7-9(8-13)3-4-11(10)14-12/h3-7H,1-2H3 |
cas번호 |
33143-29-2 |
분자 구조 |
|
밀도 |
1.13g/cm3 |
녹는 점 |
48℃ |
비등점 |
301°C at 760 mmHg |
굴절 지수 |
1.578 |
인화점 |
126.8°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|