ChemNet > CAS > 332-77-4 2,5-Dimethoxy-2,5-dihydrofuran, mixture ofcis and trans
332-77-4 2,5-Dimethoxy-2,5-dihydrofuran, mixture ofcis and trans
| 상품명칭 |
2,5-Dimethoxy-2,5-dihydrofuran, mixture ofcis and trans |
| 별명 |
2,5-Dihydro-2,5-dimethoxyfuran; 2,5-Dimethoxy-2,5-dihydrofuran; (2R,5R)-2,5-dimethoxy-2,5-dihydrofuran; (2R,5S)-2,5-dimethoxy-2,5-dihydrofuran; (2S,5S)-2,5-dimethoxy-2,5-dihydrofuran |
| 분자식 |
C6H10O3 |
| 분자량 |
130.1418 |
| InChI |
InChI=1/C6H10O3/c1-7-5-3-4-6(8-2)9-5/h3-6H,1-2H3/t5-,6-/m0/s1 |
| cas번호 |
332-77-4 |
| EC번호 |
206-367-5 |
| 분자 구조 |
|
| 밀도 |
1.06g/cm3 |
| 비등점 |
161°C at 760 mmHg |
| 굴절 지수 |
1.448 |
| 인화점 |
47.2°C |
| 위험성 표시 |
 Xn:Harmful;
|
| 리스크 규칙 |
R10:;
|
| 보안 규칙 |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S39:Wear eye/face protection.;
|
|
