ChemNet > CAS > 33974-27-5 phenyl(4-pyridyl)methanol
33974-27-5 phenyl(4-pyridyl)methanol
| 상품명칭 |
phenyl(4-pyridyl)methanol |
| 별명 |
alpha-Phenylpyridine-4-methanol; phenyl(pyridin-4-yl)methanol |
| 분자식 |
C12H11NO |
| 분자량 |
185.2218 |
| InChI |
InChI=1/C12H11NO/c14-12(10-4-2-1-3-5-10)11-6-8-13-9-7-11/h1-9,12,14H |
| cas번호 |
33974-27-5 |
| EC번호 |
251-770-1 |
| 분자 구조 |
|
| 밀도 |
1.155g/cm3 |
| 녹는 점 |
120℃ |
| 비등점 |
353.5°C at 760 mmHg |
| 굴절 지수 |
1.604 |
| 인화점 |
167.6°C |
| 위험성 표시 |
 Xn:Harmful;
|
| 리스크 규칙 |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
