ChemNet > CAS > 3430-33-9 3-amino-2,6-dimethylpyridine
3430-33-9 3-amino-2,6-dimethylpyridine
상품명칭 |
3-amino-2,6-dimethylpyridine |
별명 |
3-Amino-2,6-lutidine; 2,6-dimethylpyridin-3-amine |
분자식 |
C7H10N2 |
분자량 |
122.1677 |
InChI |
InChI=1/C7H10N2/c1-5-3-4-7(8)6(2)9-5/h3-4H,8H2,1-2H3 |
cas번호 |
3430-33-9 |
EC번호 |
222-332-7 |
분자 구조 |
|
밀도 |
1.039g/cm3 |
비등점 |
231.5°C at 760 mmHg |
굴절 지수 |
1.564 |
인화점 |
119.8°C |
위험성 표시 |
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|