ChemNet > CAS > 34688-70-5 Pentamethylphenylacetonitrile
34688-70-5 Pentamethylphenylacetonitrile
상품명칭 |
Pentamethylphenylacetonitrile |
별명 |
2,3,4,5,6-Pentamethylbenzyl cyanide |
분자식 |
C13H17N |
분자량 |
187.2808 |
InChI |
InChI=1/C13H17N/c1-8-9(2)11(4)13(6-7-14)12(5)10(8)3/h6H2,1-5H3 |
cas번호 |
34688-70-5 |
분자 구조 |
|
밀도 |
0.95g/cm3 |
녹는 점 |
105-107℃ |
비등점 |
325.9°C at 760 mmHg |
굴절 지수 |
1.519 |
인화점 |
160.2°C |
위험성 표시 |
|
리스크 규칙 |
R20/22:Harmful by inhalation and if swallowed.;
|
보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|