ChemNet > CAS > 3469-26-9 2,7-Dimethoxynaphthalene
3469-26-9 2,7-Dimethoxynaphthalene
상품명칭 |
2,7-Dimethoxynaphthalene |
별명 |
2,7-dimethoxyl Naphthalene |
분자식 |
C12H12O2 |
분자량 |
188.2225 |
InChI |
InChI=1/C12H12O2/c1-13-11-5-3-9-4-6-12(14-2)8-10(9)7-11/h3-8H,1-2H3 |
cas번호 |
3469-26-9 |
EC번호 |
222-433-6 |
분자 구조 |
|
밀도 |
1.097g/cm3 |
녹는 점 |
137-139℃ |
비등점 |
311.2°C at 760 mmHg |
굴절 지수 |
1.584 |
인화점 |
130.3°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|