ChemNet > CAS > 3481-20-7 2,3,5,6-Tetrachloroaniline
3481-20-7 2,3,5,6-Tetrachloroaniline
상품명칭 |
2,3,5,6-Tetrachloroaniline |
별명 |
NSC 29028; Aniline, 2,3,5,6-tetrachloro- (8CI); Benzenamine, 2,3,5,6-tetrachloro- (9CI) |
분자식 |
C6H3Cl4N |
분자량 |
230.9067 |
InChI |
InChI=1/C6H3Cl4N/c7-2-1-3(8)5(10)6(11)4(2)9/h1H,11H2 |
cas번호 |
3481-20-7 |
EC번호 |
222-461-9 |
분자 구조 |
|
밀도 |
1.655g/cm3 |
비등점 |
299.1°C at 760 mmHg |
굴절 지수 |
1.636 |
인화점 |
134.7°C |
위험성 표시 |
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R33:Danger of cummulative effects.;
|
보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|