ChemNet > CAS > 3512-13-8 2,3,4,6-Tetrafluoropyridine
3512-13-8 2,3,4,6-Tetrafluoropyridine
| 상품명칭 |
2,3,4,6-Tetrafluoropyridine |
| 분자식 |
C5HF4N |
| 분자량 |
151.0618 |
| InChI |
InChI=1/C5HF4N/c6-2-1-3(7)10-5(9)4(2)8/h1H |
| cas번호 |
3512-13-8 |
| 분자 구조 |
|
| 밀도 |
1.518g/cm3 |
| 비등점 |
114.6°C at 760 mmHg |
| 굴절 지수 |
1.403 |
| 인화점 |
23.1°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R34:Causes burns.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
