ChemNet > CAS > 352018-92-9 5-iodo-2-phenoxypyridine
352018-92-9 5-iodo-2-phenoxypyridine
상품명칭 |
5-iodo-2-phenoxypyridine |
분자식 |
C11H8INO |
분자량 |
297.0918 |
InChI |
InChI=1/C11H8INO/c12-9-6-7-11(13-8-9)14-10-4-2-1-3-5-10/h1-8H |
cas번호 |
352018-92-9 |
분자 구조 |
|
밀도 |
1.694g/cm3 |
비등점 |
339.8°C at 760 mmHg |
굴절 지수 |
1.646 |
인화점 |
159.3°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|