ChemNet > CAS > 352018-93-0 (1,3,5-trimethyl-1H-pyrazol-4-yl)methylamine
352018-93-0 (1,3,5-trimethyl-1H-pyrazol-4-yl)methylamine
상품명칭 |
(1,3,5-trimethyl-1H-pyrazol-4-yl)methylamine |
별명 |
1-(1,3,5-trimethyl-1H-pyrazol-4-yl)methanamine; (1,3,5-trimethyl-1H-pyrazol-4-yl)methanamine |
분자식 |
C7H13N3 |
분자량 |
139.1982 |
InChI |
InChI=1/C7H13N3/c1-5-7(4-8)6(2)10(3)9-5/h4,8H2,1-3H3 |
cas번호 |
352018-93-0 |
분자 구조 |
|
밀도 |
1.1g/cm3 |
비등점 |
247°C at 760 mmHg |
굴절 지수 |
1.556 |
인화점 |
103.2°C |
위험성 표시 |
C:Corrosive;
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|