ChemNet > CAS > 35354-37-1 1-Bromo-5-methylhexane
35354-37-1 1-Bromo-5-methylhexane
| 상품명칭 |
1-Bromo-5-methylhexane |
| 분자식 |
C7H15Br |
| 분자량 |
179.098 |
| InChI |
InChI=1/C7H15Br/c1-7(2)5-3-4-6-8/h7H,3-6H2,1-2H3 |
| cas번호 |
35354-37-1 |
| 분자 구조 |
|
| 밀도 |
1.136g/cm3 |
| 비등점 |
168°C at 760 mmHg |
| 굴절 지수 |
1.447 |
| 인화점 |
48.4°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
