ChemNet > CAS > 355022-17-2 4-(isopropylamino)-3-nitrobenzonitrile
355022-17-2 4-(isopropylamino)-3-nitrobenzonitrile
상품명칭 |
4-(isopropylamino)-3-nitrobenzonitrile |
별명 |
4-[(1-methylethyl)amino]-3-nitrobenzonitrile |
분자식 |
C10H11N3O2 |
분자량 |
205.2132 |
InChI |
InChI=1/C10H11N3O2/c1-7(2)12-9-4-3-8(6-11)5-10(9)13(14)15/h3-5,7,12H,1-2H3 |
cas번호 |
355022-17-2 |
분자 구조 |
|
밀도 |
1.21g/cm3 |
녹는 점 |
113℃ |
비등점 |
347.4°C at 760 mmHg |
굴절 지수 |
1.56 |
인화점 |
163.9°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|