ChemNet > CAS > 3612-16-6 1-Ethyl-3-methyl-4-piperidone
3612-16-6 1-Ethyl-3-methyl-4-piperidone
상품명칭 |
1-Ethyl-3-methyl-4-piperidone |
별명 |
1-ethyl-3-methylpiperidin-4-one |
분자식 |
C8H15NO |
분자량 |
141.2108 |
InChI |
InChI=1/C8H15NO/c1-3-9-5-4-8(10)7(2)6-9/h7H,3-6H2,1-2H3 |
cas번호 |
3612-16-6 |
분자 구조 |
|
밀도 |
0.931g/cm3 |
비등점 |
212.3°C at 760 mmHg |
굴절 지수 |
1.45 |
인화점 |
76.2°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|