ChemNet > CAS > 36263-51-1 1-(4-Methoxyphenyl)-1-cyclohexanecarbonitrile
36263-51-1 1-(4-Methoxyphenyl)-1-cyclohexanecarbonitrile
상품명칭 |
1-(4-Methoxyphenyl)-1-cyclohexanecarbonitrile |
별명 |
1-(4-Methoxyphenyl)cyclohexanecarbonitrile |
분자식 |
C14H17NO |
분자량 |
215.2909 |
InChI |
InChI=1/C14H17NO/c1-16-13-7-5-12(6-8-13)14(11-15)9-3-2-4-10-14/h5-8H,2-4,9-10H2,1H3 |
cas번호 |
36263-51-1 |
EC번호 |
252-938-7 |
분자 구조 |
|
밀도 |
1.06g/cm3 |
녹는 점 |
40-45℃ |
비등점 |
362°C at 760 mmHg |
굴절 지수 |
1.538 |
인화점 |
152.6°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|