ChemNet > CAS > 36304-40-2 2-Chlorophenoxyacetic acid hydrazide
36304-40-2 2-Chlorophenoxyacetic acid hydrazide
| 상품명칭 |
2-Chlorophenoxyacetic acid hydrazide |
| 별명 |
ASISCHEM U30989; AKOS BBB/158; 2-Chlorophenoxyacetic acid hydrazide 98%; 2-(2-chlorophenoxy)acetohydrazide |
| 분자식 |
C8H9ClN2O2 |
| 분자량 |
200.6223 |
| InChI |
InChI=1/C8H9ClN2O2/c9-6-3-1-2-4-7(6)13-5-8(12)11-10/h1-4H,5,10H2,(H,11,12) |
| cas번호 |
36304-40-2 |
| 분자 구조 |
|
| 밀도 |
1.324g/cm3 |
| 비등점 |
419.8°C at 760 mmHg |
| 굴절 지수 |
1.568 |
| 인화점 |
207.7°C |
| 위험성 표시 |
 Xi:;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
