ChemNet > CAS > 36401-55-5 5-methyl-2-phenyl-2H-1,2,3-triazole-4-carbonyl chloride
36401-55-5 5-methyl-2-phenyl-2H-1,2,3-triazole-4-carbonyl chloride
상품명칭 |
5-methyl-2-phenyl-2H-1,2,3-triazole-4-carbonyl chloride |
분자식 |
C10H8ClN3O |
분자량 |
221.643 |
InChI |
InChI=1/C10H8ClN3O/c1-7-9(10(11)15)13-14(12-7)8-5-3-2-4-6-8/h2-6H,1H3 |
cas번호 |
36401-55-5 |
분자 구조 |
|
밀도 |
1.36g/cm3 |
녹는 점 |
105℃ |
비등점 |
374.6°C at 760 mmHg |
굴절 지수 |
1.644 |
인화점 |
180.3°C |
위험성 표시 |
C:Corrosive;
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|