ChemNet > CAS > 36556-56-6 6-Chloro-2,4-difluoroaniline
36556-56-6 6-Chloro-2,4-difluoroaniline
| 상품명칭 |
6-Chloro-2,4-difluoroaniline |
| 별명 |
2-chloro-4,6-difluoroaniline |
| 분자식 |
C6H4ClF2N |
| 분자량 |
163.5525 |
| InChI |
InChI=1/C6H4ClF2N/c7-6-4(9)1-3(8)2-5(6)10/h1-2H,10H2 |
| cas번호 |
36556-56-6 |
| 분자 구조 |
|
| 밀도 |
1.459g/cm3 |
| 녹는 점 |
28℃ |
| 비등점 |
208.3°C at 760 mmHg |
| 굴절 지수 |
1.543 |
| 인화점 |
92.2°C |
| 위험성 표시 |
 Xn:Harmful;
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
