ChemNet > CAS > 3681-71-8 cis-3-hexenyl acetate
3681-71-8 cis-3-hexenyl acetate
상품명칭 |
cis-3-hexenyl acetate |
별명 |
Cis-3-Hexene-1-Yl Acetate; 3-Hexen-1-ol, acetate, (Z)-; ACETATO DE CIS-3-HEXENILO; Leaf acetate; Verdural extra; (Z)-3-hexenyl acetate |
분자식 |
C8H14O2 |
분자량 |
142.2 |
InChI |
InChI=1/C8H14O2/c1-3-4-5-6-7-10-8(2)9/h4-5H,3,6-7H2,1-2H3/b5-4- |
cas번호 |
3681-71-8 |
EC번호 |
222-960-1 |
분자 구조 |
|
밀도 |
0.897 |
비등점 |
75-76℃ (23 mmHg) |
굴절 지수 |
1.427 |
인화점 |
135�H |
위험성 표시 |
|
리스크 규칙 |
R36/38:Irritating to eyes and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|