ChemNet > CAS > 368870-03-5 4-(1H-pyrazol-1-yl)benzylamine
368870-03-5 4-(1H-pyrazol-1-yl)benzylamine
상품명칭 |
4-(1H-pyrazol-1-yl)benzylamine |
별명 |
1-[4-(1H-pyrazol-1-yl)phenyl]methanamine; 4-(Pyrazol-1-yl)benzylamine |
분자식 |
C10H11N3 |
분자량 |
173.2144 |
InChI |
InChI=1/C10H11N3/c11-8-9-2-4-10(5-3-9)13-7-1-6-12-13/h1-7H,8,11H2 |
cas번호 |
368870-03-5 |
분자 구조 |
|
밀도 |
1.16g/cm3 |
녹는 점 |
94℃ |
비등점 |
307.1°C at 760 mmHg |
굴절 지수 |
1.622 |
인화점 |
139.6°C |
위험성 표시 |
C:Corrosive;
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|