ChemNet > CAS > 3696-22-8 1-(4-nitrophenyl)-2-thiourea
3696-22-8 1-(4-nitrophenyl)-2-thiourea
상품명칭 |
1-(4-nitrophenyl)-2-thiourea |
별명 |
4-Nitrophenylthiourea; 1-(4-nitrophenyl)thiourea |
분자식 |
C7H7N3O2S |
분자량 |
197.2144 |
InChI |
InChI=1/C7H7N3O2S/c8-7(13)9-5-1-3-6(4-2-5)10(11)12/h1-4H,(H3,8,9,13) |
cas번호 |
3696-22-8 |
EC번호 |
223-021-9 |
분자 구조 |
|
밀도 |
1.524g/cm3 |
녹는 점 |
206℃ |
비등점 |
365.5°C at 760 mmHg |
굴절 지수 |
1.759 |
인화점 |
174.9°C |
위험성 표시 |
|
리스크 규칙 |
R25:Toxic if swallowed.;
|
보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|