ChemNet > CAS > 3752-97-4 1,4-bis(Chlormethyl)-2,5-dimethoxybenzene
3752-97-4 1,4-bis(Chlormethyl)-2,5-dimethoxybenzene
| 상품명칭 |
1,4-bis(Chlormethyl)-2,5-dimethoxybenzene |
| 별명 |
d1,4-Bis(chloromethyl)-2,5-dimethoxybenzene; 1,4-Bis(chloromethyl)-2,5-dimethoxybenzene |
| 분자식 |
C10H12Cl2O2 |
| 분자량 |
235.1071 |
| InChI |
InChI=1/C10H12Cl2O2/c1-13-9-3-8(6-12)10(14-2)4-7(9)5-11/h3-4H,5-6H2,1-2H3 |
| cas번호 |
3752-97-4 |
| 분자 구조 |
|
| 밀도 |
1.219g/cm3 |
| 녹는 점 |
164℃ |
| 비등점 |
329.2°C at 760 mmHg |
| 굴절 지수 |
1.525 |
| 인화점 |
126.2°C |
| 위험성 표시 |
 C:Corrosive;
|
| 리스크 규칙 |
R34:Causes burns.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
