ChemNet > CAS > 37529-27-4 4-heptylaniline
37529-27-4 4-heptylaniline
상품명칭 |
4-heptylaniline |
별명 |
Heptylaniline; 4-n-Heptyaniline |
분자식 |
C13H21N |
분자량 |
191.3125 |
InChI |
InChI=1/C13H21N/c1-2-3-4-5-6-7-12-8-10-13(14)11-9-12/h8-11H,2-7,14H2,1H3 |
cas번호 |
37529-27-4 |
분자 구조 |
|
밀도 |
0.923g/cm3 |
비등점 |
282.9°C at 760 mmHg |
굴절 지수 |
1.522 |
인화점 |
128.9°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|