ChemNet > CAS > 38939-88-7 3-Chloro-4-nitrotoluene
38939-88-7 3-Chloro-4-nitrotoluene
| 상품명칭 |
3-Chloro-4-nitrotoluene |
| 별명 |
2-chloro-4-methyl-1-nitrobenzene |
| 분자식 |
C7H6ClNO2 |
| 분자량 |
171.581 |
| InChI |
InChI=1/C7H6ClNO2/c1-5-2-3-7(9(10)11)6(8)4-5/h2-4H,1H3 |
| cas번호 |
38939-88-7 |
| EC번호 |
254-199-6 |
| 분자 구조 |
|
| 밀도 |
1.324g/cm3 |
| 녹는 점 |
22-27℃ |
| 비등점 |
273.4°C at 760 mmHg |
| 굴절 지수 |
1.57 |
| 인화점 |
119.1°C |
| 위험성 표시 |
 Xn:Harmful;
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
