ChemNet > CAS > 3916-18-5 DL-DOPS
3916-18-5 DL-DOPS
상품명칭 |
DL-DOPS |
별명 |
DL-threo-3,4-Dihydroxyphenylserine; D,L-dops F&D version of D-2384; H-DL-.beta.-(3,4-Dihydroxyphenyl)-DL-Ser-OH; (betaR)-beta,3-dihydroxy-L-tyrosine; (2R,3R)-2-ammonio-3-(3,4-dihydroxyphenyl)-3-hydroxypropanoate; (2Rs,3Rs)-2-Amino-3-(3,4-Dihydroxy-Phenyl)-3-Hydroxy-Propionic Acid |
분자식 |
C9H11NO5 |
분자량 |
213.1873 |
InChI |
InChI=1/C9H11NO5/c10-7(9(14)15)8(13)4-1-2-5(11)6(12)3-4/h1-3,7-8,11-13H,10H2,(H,14,15)/t7-,8-/m1/s1 |
cas번호 |
3916-18-5 |
EC번호 |
223-480-5 |
분자 구조 |
|
밀도 |
1.608g/cm3 |
녹는 점 |
200℃ |
비등점 |
549.8°C at 760 mmHg |
굴절 지수 |
1.692 |
인화점 |
286.3°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|