ChemNet > CAS > 39593-08-3 Methylphenylpiperazine
39593-08-3 Methylphenylpiperazine
상품명칭 |
Methylphenylpiperazine |
별명 |
1-(4-Methylphenyl)piperazine; N-(p-Tolyl)piperazine; 1-p-tolylpiperazine |
분자식 |
C11H16N2 |
분자량 |
176.2581 |
InChI |
InChI=1/C11H16N2/c1-10-2-4-11(5-3-10)13-8-6-12-7-9-13/h2-5,12H,6-9H2,1H3 |
cas번호 |
39593-08-3 |
EC번호 |
254-534-6 |
분자 구조 |
|
밀도 |
1.012g/cm3 |
비등점 |
321.2°C at 760 mmHg |
굴절 지수 |
1.54 |
인화점 |
153.8°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|