CAS No: 3999-42-6, Chemical Name: borane-2,6-lutidine complex
Home | Products | Suppliers | Offer to Buy | Offer to Sell | Chemical News | Resource
Chemical CAS Database with Global Chemical Suppliers - ChemNet

Updated CAS

the physical and chemical property of 3999-42-6, borane-2,6-lutidine complex is provided by ChemNet.com

  ChemNet > CAS > 3999-42-6 borane-2,6-lutidine complex

3999-42-6 borane-2,6-lutidine complex

상품명칭 borane-2,6-lutidine complex
별명 2,6-dimethylpyridine-borane
분자식 C7H12BN
분자량 120.98
InChI InChI=1/C7H12BN/c1-6-4-3-5-7(2)9(6)8/h3-5H,1-2,8H3/q+1
cas번호 3999-42-6
EC번호 223-645-1
분자 구조 3999-42-6 borane-2,6-lutidine complex
위험성 표시
리스크 규칙
보안 규칙