ChemNet > CAS > 40004-08-8 N-(Carboethoxymethyl)piperazine
40004-08-8 N-(Carboethoxymethyl)piperazine
상품명칭 |
N-(Carboethoxymethyl)piperazine |
별명 |
Ethyl (1-piperazino)acetate; (1-Piperazino)acetic acid ethyl ester; 1-(Ethoxycarbonylmethyl)piperazine; ethyl piperazin-1-ylacetate; Ethyl 1-piperazinylacetate |
분자식 |
C8H16N2O2 |
분자량 |
172.2248 |
InChI |
InChI=1/C8H16N2O2/c1-2-12-8(11)7-10-5-3-9-4-6-10/h9H,2-7H2,1H3 |
cas번호 |
40004-08-8 |
EC번호 |
254-745-3 |
분자 구조 |
|
밀도 |
1.027g/cm3 |
비등점 |
252.5°C at 760 mmHg |
굴절 지수 |
1.457 |
인화점 |
106.5°C |
위험성 표시 |
|
리스크 규칙 |
R36/38:Irritating to eyes and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|