ChemNet > CAS > 4023-65-8 trans-Aconitic acid
4023-65-8 trans-Aconitic acid
상품명칭 |
trans-Aconitic acid |
별명 |
trans-Aconitic acid, (1,2,3-Propenetricarboxylic acid); (1E)-prop-1-ene-1,2,3-tricarboxylic acid; (1Z)-prop-1-ene-1,2,3-tricarboxylate |
분자식 |
C6H3O6 |
분자량 |
171.0861 |
InChI |
InChI=1/C6H6O6/c7-4(8)1-3(6(11)12)2-5(9)10/h1H,2H2,(H,7,8)(H,9,10)(H,11,12)/p-3/b3-1- |
cas번호 |
4023-65-8 |
EC번호 |
223-688-6 |
분자 구조 |
|
녹는 점 |
190℃ |
비등점 |
542.6°C at 760 mmHg |
인화점 |
296°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|