ChemNet > CAS > 40397-98-6 2,5-dimethylphenyl isocyanate
40397-98-6 2,5-dimethylphenyl isocyanate
| 상품명칭 |
2,5-dimethylphenyl isocyanate |
| 별명 |
2,5-Isocyanatoxylene; 2-isocyanato-1,4-dimethylbenzene |
| 분자식 |
C9H9NO |
| 분자량 |
147.1739 |
| InChI |
InChI=1/C9H9NO/c1-7-3-4-8(2)9(5-7)10-6-11/h3-5H,1-2H3 |
| cas번호 |
40397-98-6 |
| 분자 구조 |
|
| 밀도 |
0.98g/cm3 |
| 비등점 |
224.4°C at 760 mmHg |
| 굴절 지수 |
1.515 |
| 인화점 |
78.8°C |
| 위험성 표시 |
 Xn:Harmful;
|
| 리스크 규칙 |
R23/25:Toxic by inhalation and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
R42:May cause sensitization by inhalation.;
|
| 보안 규칙 |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
