ChemNet > CAS > 40771-26-4 1,5-Dihydroxy-1,2,3,4-tetrahydronaphthalene
40771-26-4 1,5-Dihydroxy-1,2,3,4-tetrahydronaphthalene
상품명칭 |
1,5-Dihydroxy-1,2,3,4-tetrahydronaphthalene |
별명 |
1,2,3,4-Tetrahydro-1,5-naphthalenediol; 1,2,3,4-tetrahydronaphthalene-1,5-diol; (1R)-1,2,3,4-tetrahydronaphthalene-1,5-diol; (1S)-1,2,3,4-tetrahydronaphthalene-1,5-diol |
분자식 |
C10H12O2 |
분자량 |
164.2011 |
InChI |
InChI=1/C10H12O2/c11-9-5-1-3-7-8(9)4-2-6-10(7)12/h1,3,5,10-12H,2,4,6H2/t10-/m0/s1 |
cas번호 |
40771-26-4 |
EC번호 |
255-070-7 |
분자 구조 |
|
밀도 |
1.246g/cm3 |
녹는 점 |
132-134℃ |
비등점 |
325.9°C at 760 mmHg |
굴절 지수 |
1.624 |
인화점 |
162.4°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|