ChemNet > CAS > 4079-52-1 2-Methoxyacetophenone
4079-52-1 2-Methoxyacetophenone
상품명칭 |
2-Methoxyacetophenone |
별명 |
2-Acetylanisole; alpha-Methoxyacetophenone; 2-methoxy-1-phenylethanone; 1-(2-methoxyphenyl)ethanone |
분자식 |
C9H10O2 |
분자량 |
150.1745 |
InChI |
InChI=1/C9H10O2/c1-7(10)8-5-3-4-6-9(8)11-2/h3-6H,1-2H3 |
cas번호 |
4079-52-1 |
EC번호 |
223-802-4 |
분자 구조 |
|
밀도 |
1.035g/cm3 |
녹는 점 |
7-8℃ |
비등점 |
245°C at 760 mmHg |
굴절 지수 |
1.504 |
인화점 |
92.8°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|