ChemNet > CAS > 4160-63-8 2-(4-Methoxybenzoyl)thiophene
4160-63-8 2-(4-Methoxybenzoyl)thiophene
상품명칭 |
2-(4-Methoxybenzoyl)thiophene |
별명 |
p-anisyl thiophen-2-yl ketone; (4-methoxyphenyl)(thiophen-2-yl)methanone; (4-methylphenyl)(thiophen-2-yl)methanone |
분자식 |
C12H10OS |
분자량 |
202.2722 |
InChI |
InChI=1/C12H10OS/c1-9-4-6-10(7-5-9)12(13)11-3-2-8-14-11/h2-8H,1H3 |
cas번호 |
4160-63-8 |
EC번호 |
223-997-6 |
분자 구조 |
|
밀도 |
1.167g/cm3 |
녹는 점 |
73-76℃ |
비등점 |
340.6°C at 760 mmHg |
굴절 지수 |
1.599 |
인화점 |
159.8°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|