ChemNet > CAS > 4228-10-8 5-Acetylindane,97%
4228-10-8 5-Acetylindane,97%
상품명칭 |
5-Acetylindane,97% |
별명 |
indan-5-yl methyl ketone; Acetylindane; 1-(2,3-Dihydro-1H-inden-5-yl)ethan-1-one; 1-(2,3-dihydro-1H-inden-1-yl)ethanone; 1-(2,3-dihydro-1H-inden-5-yl)ethanone |
분자식 |
C11H12O |
분자량 |
160.2124 |
InChI |
InChI=1/C11H12O/c1-8(12)10-6-5-9-3-2-4-11(9)7-10/h5-7H,2-4H2,1H3 |
cas번호 |
4228-10-8 |
분자 구조 |
|
밀도 |
1.067g/cm3 |
비등점 |
291.4°C at 760 mmHg |
굴절 지수 |
1.559 |
인화점 |
123.5°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|