ChemNet > CAS > 423768-52-9 (1,5-dimethyl-1H-pyrazol-3-yl)methylamine
423768-52-9 (1,5-dimethyl-1H-pyrazol-3-yl)methylamine
| 상품명칭 |
(1,5-dimethyl-1H-pyrazol-3-yl)methylamine |
| 별명 |
1-(1,5-dimethyl-1H-pyrazol-3-yl)methanamine; (1,5-dimethyl-1H-pyrazol-3-yl)methanamine |
| 분자식 |
C6H11N3 |
| 분자량 |
125.1716 |
| InChI |
InChI=1/C6H11N3/c1-5-3-6(4-7)8-9(5)2/h3H,4,7H2,1-2H3 |
| cas번호 |
423768-52-9 |
| 분자 구조 |
|
| 밀도 |
1.12g/cm3 |
| 비등점 |
229.3°C at 760 mmHg |
| 굴절 지수 |
1.566 |
| 인화점 |
92.5°C |
| 위험성 표시 |
 C:Corrosive;
|
| 리스크 규칙 |
R34:Causes burns.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
