ChemNet > CAS > 4245-37-8 vinyl methacrylate
4245-37-8 vinyl methacrylate
| 상품명칭 |
vinyl methacrylate |
| 별명 |
Vinyl methacrylate, (Methacrylic acid vinyl ester); Methacrylic acid vinyl ester; ethenyl 2-methylprop-2-enoate |
| 분자식 |
C6H8O2 |
| 분자량 |
112.1265 |
| InChI |
InChI=1/C6H8O2/c1-4-8-6(7)5(2)3/h4H,1-2H2,3H3 |
| cas번호 |
4245-37-8 |
| EC번호 |
224-205-1 |
| 분자 구조 |
|
| 밀도 |
0.926g/cm3 |
| 비등점 |
123.3°C at 760 mmHg |
| 굴절 지수 |
1.424 |
| 인화점 |
28.8°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R11:Highly flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28:After contact with skin, wash immediately with plenty of ...;
|
|
