ChemNet > CAS > 4295-06-1 4-Chloroquinaldine
4295-06-1 4-Chloroquinaldine
상품명칭 |
4-Chloroquinaldine |
별명 |
4-Chloro-2-methylquinoline; 2-Methyl-4-chloroquinoline |
분자식 |
C10H8ClN |
분자량 |
177.6302 |
InChI |
InChI=1/C10H8ClN/c1-7-6-9(11)8-4-2-3-5-10(8)12-7/h2-6H,1H3 |
cas번호 |
4295-06-1 |
EC번호 |
224-300-8 |
분자 구조 |
|
밀도 |
1.225g/cm3 |
녹는 점 |
39-270℃ |
비등점 |
269.5°C at 760 mmHg |
굴절 지수 |
1.634 |
인화점 |
140.2°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|