ChemNet > CAS > 4295-06-1 4-Chloroquinaldine
4295-06-1 4-Chloroquinaldine
| 상품명칭 |
4-Chloroquinaldine |
| 별명 |
4-Chloro-2-methylquinoline; 2-Methyl-4-chloroquinoline |
| 분자식 |
C10H8ClN |
| 분자량 |
177.6302 |
| InChI |
InChI=1/C10H8ClN/c1-7-6-9(11)8-4-2-3-5-10(8)12-7/h2-6H,1H3 |
| cas번호 |
4295-06-1 |
| EC번호 |
224-300-8 |
| 분자 구조 |
|
| 밀도 |
1.225g/cm3 |
| 녹는 점 |
39-270℃ |
| 비등점 |
269.5°C at 760 mmHg |
| 굴절 지수 |
1.634 |
| 인화점 |
140.2°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
