ChemNet > CAS > 43020-38-8 2,3,4-Trimethoxybenzonitrile
43020-38-8 2,3,4-Trimethoxybenzonitrile
상품명칭 |
2,3,4-Trimethoxybenzonitrile |
분자식 |
C10H11NO3 |
분자량 |
193.1992 |
InChI |
InChI=1/C10H11NO3/c1-12-8-5-4-7(6-11)9(13-2)10(8)14-3/h4-5H,1-3H3 |
cas번호 |
43020-38-8 |
EC번호 |
256-049-5 |
분자 구조 |
|
밀도 |
1.15g/cm3 |
녹는 점 |
55-57℃ |
비등점 |
311.1°C at 760 mmHg |
굴절 지수 |
1.514 |
인화점 |
127.8°C |
위험성 표시 |
T:Toxic;
|
리스크 규칙 |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|