ChemNet > CAS > 4395-87-3 4-Isopropylphenylacetonitrile
4395-87-3 4-Isopropylphenylacetonitrile
상품명칭 |
4-Isopropylphenylacetonitrile |
별명 |
[4-(propan-2-yl)phenyl]acetonitrile |
분자식 |
C11H13N |
분자량 |
159.2276 |
InChI |
InChI=1/C11H13N/c1-9(2)11-5-3-10(4-6-11)7-8-12/h3-6,9H,7H2,1-2H3 |
cas번호 |
4395-87-3 |
분자 구조 |
|
밀도 |
0.96g/cm3 |
비등점 |
261.1°C at 760 mmHg |
굴절 지수 |
1.514 |
인화점 |
117.5°C |
위험성 표시 |
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|