ChemNet > CAS > 4424-17-3 2-Aminobenzanilide
4424-17-3 2-Aminobenzanilide
상품명칭 |
2-Aminobenzanilide |
별명 |
2-Amino-N-phenylbenzamide~Phenylanthranilamide; 2-amino-N-phenylbenzamide; N-(2-aminophenyl)benzamide |
분자식 |
C13H12N2O |
분자량 |
212.2472 |
InChI |
InChI=1/C13H12N2O/c14-11-8-4-5-9-12(11)15-13(16)10-6-2-1-3-7-10/h1-9H,14H2,(H,15,16) |
cas번호 |
4424-17-3 |
EC번호 |
224-599-5 |
분자 구조 |
|
밀도 |
1.244g/cm3 |
비등점 |
293.2°C at 760 mmHg |
굴절 지수 |
1.688 |
인화점 |
131.1°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|