ChemNet > CAS > 4433-30-1 Undecanophenone
4433-30-1 Undecanophenone
상품명칭 |
Undecanophenone |
별명 |
n-Decyl phenyl ketone; 1-phenylundecan-2-one |
분자식 |
C17H26O |
분자량 |
246.3877 |
InChI |
InChI=1/C17H26O/c1-2-3-4-5-6-7-11-14-17(18)15-16-12-9-8-10-13-16/h8-10,12-13H,2-7,11,14-15H2,1H3 |
cas번호 |
4433-30-1 |
EC번호 |
224-633-9 |
분자 구조 |
|
밀도 |
0.92g/cm3 |
녹는 점 |
28-30℃ |
비등점 |
342.846°C at 760 mmHg |
굴절 지수 |
1.49 |
인화점 |
114.968°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|