ChemNet > CAS > 4472-41-7 N,N-Dimethylformamide-d7
4472-41-7 N,N-Dimethylformamide-d7
| 상품명칭 |
N,N-Dimethylformamide-d7 |
| 별명 |
Dimethylformamidedisotopicpurity; N,N-bis[(~2~H_3_)methyl](~2~H)formamide; N,N-bis[(~2~H_3_)methyl]formamide |
| 분자식 |
C3HD6NO |
| 분자량 |
79.1308 |
| InChI |
InChI=1/C3H7NO/c1-4(2)3-5/h3H,1-2H3/i1D3,2D3 |
| cas번호 |
4472-41-7 |
| EC번호 |
224-745-8 |
| 분자 구조 |
|
| 밀도 |
0.958g/cm3 |
| 비등점 |
152.999°C at 760 mmHg |
| 굴절 지수 |
1.396 |
| 인화점 |
57.778°C |
| 위험성 표시 |
 T:Toxic;
|
| 리스크 규칙 |
R20/21:Harmful by inhalation and in contact with skin.;
R36:Irritating to eyes.;
R61:May cause harm to the unborn child.;
|
| 보안 규칙 |
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S53:Avoid exposure - obtain special instructions before use.;
|
|
