CAS No: 2826-19-9;4488-57-7, Chemical Name: 3a,4,5,6,7,7a-hexahydro-1H-4,7-methanoindene
the physical and chemical property of 2826-19-9;4488-57-7, 3a,4,5,6,7,7a-hexahydro-1H-4,7-methanoindene is provided by ChemNet.com
ChemNet > CAS > 2826-19-9;4488-57-7 3a,4,5,6,7,7a-hexahydro-1H-4,7-methanoindene
2826-19-9;4488-57-7 3a,4,5,6,7,7a-hexahydro-1H-4,7-methanoindene
| 상품명칭 |
3a,4,5,6,7,7a-hexahydro-1H-4,7-methanoindene |
| 별명 |
5,6-Dihydrodicyclopentadiene; ; (1R,2S,6R,7S)-Tricyclo[5.2.1.02,6]dec-8-ene; (3aR,4S,7R,7aS)-2,3,3a,4,7,7a-hexahydro-1H-4,7-methanoindene |
| 분자식 |
C10H14 |
| 분자량 |
134.2182 |
| InChI |
InChI=1/C10H14/c1-2-9-7-4-5-8(6-7)10(9)3-1/h1-2,7-10H,3-6H2 |
| cas번호 |
2826-19-9;4488-57-7 |
| EC번호 |
224-778-8 |
| 분자 구조 |
|
| 밀도 |
1.011g/cm3 |
| 비등점 |
185.6°C at 760 mmHg |
| 굴절 지수 |
1.542 |
| 인화점 |
53.5°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
|
|
