ChemNet > CAS > 4521-33-9 5-Nitrothiophene-2-carboxaldehyde
4521-33-9 5-Nitrothiophene-2-carboxaldehyde
상품명칭 |
5-Nitrothiophene-2-carboxaldehyde |
별명 |
5-Nitrothiophene-2-carbaldehyde |
분자식 |
C5H3NO3S |
분자량 |
157.1472 |
InChI |
InChI=1/C5H3NO3S/c7-3-4-1-2-5(10-4)6(8)9/h1-3H |
cas번호 |
4521-33-9 |
EC번호 |
224-850-9 |
분자 구조 |
|
밀도 |
1.534g/cm3 |
비등점 |
297.2°C at 760 mmHg |
굴절 지수 |
1.662 |
인화점 |
133.5°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|