ChemNet > CAS > 455-67-4 3-fluoropropiophenone
455-67-4 3-fluoropropiophenone
상품명칭 |
3-fluoropropiophenone |
별명 |
3'-FLUOROPROPIOPHENONE; 1-(3-fluorophenyl)propan-1-one |
분자식 |
C9H9FO |
분자량 |
152.1656 |
InChI |
InChI=1/C9H9FO/c1-2-9(11)7-4-3-5-8(10)6-7/h3-6H,2H2,1H3 |
cas번호 |
455-67-4 |
분자 구조 |
|
밀도 |
1.074g/cm3 |
비등점 |
209.8°C at 760 mmHg |
굴절 지수 |
1.489 |
인화점 |
79.8°C |
위험성 표시 |
|
리스크 규칙 |
R36/38:Irritating to eyes and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|