ChemNet > CAS > 459-05-2 1-(4-fluorophenyl)-2-thiourea
459-05-2 1-(4-fluorophenyl)-2-thiourea
| 상품명칭 |
1-(4-fluorophenyl)-2-thiourea |
| 별명 |
4-Fluorophenylthiourea; 1-(4-fluorophenyl)thiourea |
| 분자식 |
C7H7FN2S |
| 분자량 |
170.2073 |
| InChI |
InChI=1/C7H7FN2S/c8-5-1-3-6(4-2-5)10-7(9)11/h1-4H,(H3,9,10,11) |
| cas번호 |
459-05-2 |
| 분자 구조 |
|
| 밀도 |
1.397g/cm3 |
| 녹는 점 |
164℃ |
| 비등점 |
264.2°C at 760 mmHg |
| 굴절 지수 |
1.692 |
| 인화점 |
113.6°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R25:Toxic if swallowed.;
|
| 보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
